C30H29N3O5S — CID 91524760
S-[2-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]ethylcarbamoylamino] 2-phenylcyclopropane-1-carbothioate (PubChem CID 91524760) has the molecular formula C30H29N3O5S and a molecular weight of 543.65 g/mol. Its IUPAC name is S-[2-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]ethylcarbamoylamino] 2-phenylcyclopropane-1-carbothioate.
| Compound Name | S-[2-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]ethylcarbamoylamino] 2-phenylcyclopropane-1-carbothioate |
|---|---|
| PubChem CID | 91524760 |
| Molecular Formula | C30H29N3O5S |
| Molecular Weight | 543.65 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | S-[2-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]ethylcarbamoylamino] 2-phenylcyclopropane-1-carbothioate |
| SMILES | COc1cc2nccc(Oc3ccc(CCNC(=O)NSC(=O)C4CC4c4ccccc4)cc3)c2cc1OC |
| InChI | InChI=1S/C30H29N3O5S/c1-36-27-17-24-25(18-28(27)37-2)31-15-13-26(24)38-21-10-8-19(9-11-21)12-14-32-30(35)33-39-29(34)23-16-22(23)20-6-4-3-5-7-20/h3-11,13,15,17-18,22-23H,12,14,16H2,1-2H3,(H2,32,33,35) |
| InChIKey | FNYLZHBOCOGBEF-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.65 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|