C27H21ClN2O3S — CID 143083683
N-(4-chlorophenyl)sulfanyl-6-(6,7-dimethoxyquinolin-4-yl)oxynaphthalen-1-amine (PubChem CID 143083683) has the molecular formula C27H21ClN2O3S and a molecular weight of 489.00 g/mol. Its IUPAC name is N-(4-chlorophenyl)sulfanyl-6-(6,7-dimethoxyquinolin-4-yl)oxynaphthalen-1-amine.
| Compound Name | N-(4-chlorophenyl)sulfanyl-6-(6,7-dimethoxyquinolin-4-yl)oxynaphthalen-1-amine |
|---|---|
| PubChem CID | 143083683 |
| Molecular Formula | C27H21ClN2O3S |
| Molecular Weight | 489.00 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | N-(4-chlorophenyl)sulfanyl-6-(6,7-dimethoxyquinolin-4-yl)oxynaphthalen-1-amine |
| SMILES | COc1cc2nccc(Oc3ccc4c(NSc5ccc(Cl)cc5)cccc4c3)c2cc1OC |
| InChI | InChI=1S/C27H21ClN2O3S/c1-31-26-15-22-24(16-27(26)32-2)29-13-12-25(22)33-19-8-11-21-17(14-19)4-3-5-23(21)30-34-20-9-6-18(28)7-10-20/h3-16,30H,1-2H3 |
| InChIKey | HJUQKZHXKVNINU-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.00 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|