C29H32FNO4S — CID 58249526
5-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-1-(4-methylcyclohexyl)-4-sulfanylidenepentan-2-one (PubChem CID 58249526) has the molecular formula C29H32FNO4S and a molecular weight of 509.64 g/mol. Its IUPAC name is 5-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-1-(4-methylcyclohexyl)-4-sulfanylidenepentan-2-one.
| Compound Name | 5-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-1-(4-methylcyclohexyl)-4-sulfanylidenepentan-2-one |
|---|---|
| PubChem CID | 58249526 |
| Molecular Formula | C29H32FNO4S |
| Molecular Weight | 509.64 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | 5-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-1-(4-methylcyclohexyl)-4-sulfanylidenepentan-2-one |
| SMILES | COc1cc2nccc(Oc3ccc(CC(=S)CC(=O)CC4CCC(C)CC4)cc3F)c2cc1OC |
| InChI | InChI=1S/C29H32FNO4S/c1-18-4-6-19(7-5-18)12-21(32)15-22(36)13-20-8-9-27(24(30)14-20)35-26-10-11-31-25-17-29(34-3)28(33-2)16-23(25)26/h8-11,14,16-19H,4-7,12-13,15H2,1-3H3 |
| InChIKey | SUMGOHJVQXBDDH-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.64 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|