C23H20ClFN2O3S — CID 147640053
4-[3-chloro-4-(3-cyclopropyl-2-sulfanylidenepropyl)-2-fluorophenoxy]-7-methoxyquinoline-6-carboxamide (PubChem CID 147640053) has the molecular formula C23H20ClFN2O3S and a molecular weight of 458.94 g/mol. Its IUPAC name is 4-[3-chloro-4-(3-cyclopropyl-2-sulfanylidenepropyl)-2-fluorophenoxy]-7-methoxyquinoline-6-carboxamide.
| Compound Name | 4-[3-chloro-4-(3-cyclopropyl-2-sulfanylidenepropyl)-2-fluorophenoxy]-7-methoxyquinoline-6-carboxamide |
|---|---|
| PubChem CID | 147640053 |
| Molecular Formula | C23H20ClFN2O3S |
| Molecular Weight | 458.94 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | 4-[3-chloro-4-(3-cyclopropyl-2-sulfanylidenepropyl)-2-fluorophenoxy]-7-methoxyquinoline-6-carboxamide |
| SMILES | COc1cc2nccc(Oc3ccc(CC(=S)CC4CC4)c(Cl)c3F)c2cc1C(N)=O |
| InChI | InChI=1S/C23H20ClFN2O3S/c1-29-20-11-17-15(10-16(20)23(26)28)18(6-7-27-17)30-19-5-4-13(21(24)22(19)25)9-14(31)8-12-2-3-12/h4-7,10-12H,2-3,8-9H2,1H3,(H2,26,28) |
| InChIKey | GHKYGJUCSLMHIY-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.94 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|