C19H17ClFN3O4 — CID 174194248
4-(4-amino-3-chloro-2-ethoxy-6-fluorophenoxy)-7-methoxyquinoline-6-carboxamide (PubChem CID 174194248) has the molecular formula C19H17ClFN3O4 and a molecular weight of 405.81 g/mol. Its IUPAC name is 4-(4-amino-3-chloro-2-ethoxy-6-fluorophenoxy)-7-methoxyquinoline-6-carboxamide.
| Compound Name | 4-(4-amino-3-chloro-2-ethoxy-6-fluorophenoxy)-7-methoxyquinoline-6-carboxamide |
|---|---|
| PubChem CID | 174194248 |
| Molecular Formula | C19H17ClFN3O4 |
| Molecular Weight | 405.81 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 4-(4-amino-3-chloro-2-ethoxy-6-fluorophenoxy)-7-methoxyquinoline-6-carboxamide |
| SMILES | CCOc1c(Cl)c(N)cc(F)c1Oc1ccnc2cc(OC)c(C(N)=O)cc12 |
| InChI | InChI=1S/C19H17ClFN3O4/c1-3-27-18-16(20)12(22)7-11(21)17(18)28-14-4-5-24-13-8-15(26-2)10(19(23)25)6-9(13)14/h4-8H,3,22H2,1-2H3,(H2,23,25) |
| InChIKey | FOXXPKVKGUXDAM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 109.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.81 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|