C24H25ClFN5O4S — CID 134333997
4-[3-chloro-2-fluoro-4-[[2-(methoxymethyl)pyrrolidin-1-yl]carbamothioylamino]phenoxy]-7-methoxyquinoline-6-carboxamide (PubChem CID 134333997) has the molecular formula C24H25ClFN5O4S and a molecular weight of 534.01 g/mol. Its IUPAC name is 4-[3-chloro-2-fluoro-4-[[2-(methoxymethyl)pyrrolidin-1-yl]carbamothioylamino]phenoxy]-7-methoxyquinoline-6-carboxamide.
| Compound Name | 4-[3-chloro-2-fluoro-4-[[2-(methoxymethyl)pyrrolidin-1-yl]carbamothioylamino]phenoxy]-7-methoxyquinoline-6-carboxamide |
|---|---|
| PubChem CID | 134333997 |
| Molecular Formula | C24H25ClFN5O4S |
| Molecular Weight | 534.01 g/mol |
| Exact Mass | 533.13 |
| IUPAC Name | 4-[3-chloro-2-fluoro-4-[[2-(methoxymethyl)pyrrolidin-1-yl]carbamothioylamino]phenoxy]-7-methoxyquinoline-6-carboxamide |
| SMILES | COCC1CCCN1NC(=S)Nc1ccc(Oc2ccnc3cc(OC)c(C(N)=O)cc23)c(F)c1Cl |
| InChI | InChI=1S/C24H25ClFN5O4S/c1-33-12-13-4-3-9-31(13)30-24(36)29-16-5-6-19(22(26)21(16)25)35-18-7-8-28-17-11-20(34-2)15(23(27)32)10-14(17)18/h5-8,10-11,13H,3-4,9,12H2,1-2H3,(H2,27,32)(H2,29,30,36) |
| InChIKey | KMCDZVGEBOSXLV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 110.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.01 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|