C22H21ClN4O2 — CID 22937024
4-(3-amino-4-chlorophenoxy)-7-(2-pyrrolidin-1-ylethoxy)quinoline-6-carbonitrile (PubChem CID 22937024) has the molecular formula C22H21ClN4O2 and a molecular weight of 408.89 g/mol. Its IUPAC name is 4-(3-amino-4-chlorophenoxy)-7-(2-pyrrolidin-1-ylethoxy)quinoline-6-carbonitrile.
| Compound Name | 4-(3-amino-4-chlorophenoxy)-7-(2-pyrrolidin-1-ylethoxy)quinoline-6-carbonitrile |
|---|---|
| PubChem CID | 22937024 |
| Molecular Formula | C22H21ClN4O2 |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 4-(3-amino-4-chlorophenoxy)-7-(2-pyrrolidin-1-ylethoxy)quinoline-6-carbonitrile |
| SMILES | N#Cc1cc2c(Oc3ccc(Cl)c(N)c3)ccnc2cc1OCCN1CCCC1 |
| InChI | InChI=1S/C22H21ClN4O2/c23-18-4-3-16(12-19(18)25)29-21-5-6-26-20-13-22(15(14-24)11-17(20)21)28-10-9-27-7-1-2-8-27/h3-6,11-13H,1-2,7-10,25H2 |
| InChIKey | KAIUGNKURDVEAD-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 84.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|