C25H23FN4O2 — CID 10113512
4-[(6-fluoro-1H-indol-5-yl)oxy]-7-(3-pyrrolidin-1-ylpropoxy)quinoline-6-carbonitrile (PubChem CID 10113512) has the molecular formula C25H23FN4O2 and a molecular weight of 430.48 g/mol. Its IUPAC name is 4-[(6-fluoro-1H-indol-5-yl)oxy]-7-(3-pyrrolidin-1-ylpropoxy)quinoline-6-carbonitrile.
| Compound Name | 4-[(6-fluoro-1H-indol-5-yl)oxy]-7-(3-pyrrolidin-1-ylpropoxy)quinoline-6-carbonitrile |
|---|---|
| PubChem CID | 10113512 |
| Molecular Formula | C25H23FN4O2 |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 4-[(6-fluoro-1H-indol-5-yl)oxy]-7-(3-pyrrolidin-1-ylpropoxy)quinoline-6-carbonitrile |
| SMILES | N#Cc1cc2c(Oc3cc4cc[nH]c4cc3F)ccnc2cc1OCCCN1CCCC1 |
| InChI | InChI=1S/C25H23FN4O2/c26-20-14-21-17(4-6-28-21)13-25(20)32-23-5-7-29-22-15-24(18(16-27)12-19(22)23)31-11-3-10-30-8-1-2-9-30/h4-7,12-15,28H,1-3,8-11H2 |
| InChIKey | PPMXVQVFDKPOOU-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|