C19H18N2O4 — CID 69131598
7-methoxy-4-(3-methoxyphenoxy)-N-methylquinoline-6-carboxamide (PubChem CID 69131598) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is 7-methoxy-4-(3-methoxyphenoxy)-N-methylquinoline-6-carboxamide.
| Compound Name | 7-methoxy-4-(3-methoxyphenoxy)-N-methylquinoline-6-carboxamide |
|---|---|
| PubChem CID | 69131598 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 7-methoxy-4-(3-methoxyphenoxy)-N-methylquinoline-6-carboxamide |
| SMILES | CNC(=O)c1cc2c(Oc3cccc(OC)c3)ccnc2cc1OC |
| InChI | InChI=1S/C19H18N2O4/c1-20-19(22)15-10-14-16(11-18(15)24-3)21-8-7-17(14)25-13-6-4-5-12(9-13)23-2/h4-11H,1-3H3,(H,20,22) |
| InChIKey | NIWQRWNHBFTCSV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |