C32H39ClN2O5 — CID 157253214
1-[2-chloro-4-[6-methoxy-7-[3-(2-oxa-7-azaspiro[3.5]nonan-7-yl)propoxy]quinolin-4-yl]oxyphenyl]hexan-2-one (PubChem CID 157253214) has the molecular formula C32H39ClN2O5 and a molecular weight of 567.13 g/mol. Its IUPAC name is 1-[2-chloro-4-[6-methoxy-7-[3-(2-oxa-7-azaspiro[3.5]nonan-7-yl)propoxy]quinolin-4-yl]oxyphenyl]hexan-2-one.
| Compound Name | 1-[2-chloro-4-[6-methoxy-7-[3-(2-oxa-7-azaspiro[3.5]nonan-7-yl)propoxy]quinolin-4-yl]oxyphenyl]hexan-2-one |
|---|---|
| PubChem CID | 157253214 |
| Molecular Formula | C32H39ClN2O5 |
| Molecular Weight | 567.13 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | 1-[2-chloro-4-[6-methoxy-7-[3-(2-oxa-7-azaspiro[3.5]nonan-7-yl)propoxy]quinolin-4-yl]oxyphenyl]hexan-2-one |
| SMILES | CCCCC(=O)Cc1ccc(Oc2ccnc3cc(OCCCN4CCC5(CC4)COC5)c(OC)cc23)cc1Cl |
| InChI | InChI=1S/C32H39ClN2O5/c1-3-4-6-24(36)17-23-7-8-25(18-27(23)33)40-29-9-12-34-28-20-31(30(37-2)19-26(28)29)39-16-5-13-35-14-10-32(11-15-35)21-38-22-32/h7-9,12,18-20H,3-6,10-11,13-17,21-22H2,1-2H3 |
| InChIKey | WWMRBOIWQFBPPT-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 70.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.13 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|