C32H38ClN3O6 — CID 158176364
1-[2-chloro-4-[6-methoxy-7-[4-(2-oxa-7-azaspiro[3.5]nonan-7-yl)-4-oxobutoxy]quinazolin-4-yl]oxyphenyl]hexan-2-one (PubChem CID 158176364) has the molecular formula C32H38ClN3O6 and a molecular weight of 596.12 g/mol. Its IUPAC name is 1-[2-chloro-4-[6-methoxy-7-[4-(2-oxa-7-azaspiro[3.5]nonan-7-yl)-4-oxobutoxy]quinazolin-4-yl]oxyphenyl]hexan-2-one.
| Compound Name | 1-[2-chloro-4-[6-methoxy-7-[4-(2-oxa-7-azaspiro[3.5]nonan-7-yl)-4-oxobutoxy]quinazolin-4-yl]oxyphenyl]hexan-2-one |
|---|---|
| PubChem CID | 158176364 |
| Molecular Formula | C32H38ClN3O6 |
| Molecular Weight | 596.12 g/mol |
| Exact Mass | 595.24 |
| IUPAC Name | 1-[2-chloro-4-[6-methoxy-7-[4-(2-oxa-7-azaspiro[3.5]nonan-7-yl)-4-oxobutoxy]quinazolin-4-yl]oxyphenyl]hexan-2-one |
| SMILES | CCCCC(=O)Cc1ccc(Oc2ncnc3cc(OCCCC(=O)N4CCC5(CC4)COC5)c(OC)cc23)cc1Cl |
| InChI | InChI=1S/C32H38ClN3O6/c1-3-4-6-23(37)15-22-8-9-24(16-26(22)33)42-31-25-17-28(39-2)29(18-27(25)34-21-35-31)41-14-5-7-30(38)36-12-10-32(11-13-36)19-40-20-32/h8-9,16-18,21H,3-7,10-15,19-20H2,1-2H3 |
| InChIKey | DLZAVRBOGOVFNU-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 100.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.12 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|