C25H37N5O3 — CID 163722459
1-[6-methoxy-2-pyrrolidin-1-yl-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-yl]piperidin-2-ol (PubChem CID 163722459) has the molecular formula C25H37N5O3 and a molecular weight of 455.60 g/mol. Its IUPAC name is 1-[6-methoxy-2-pyrrolidin-1-yl-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-yl]piperidin-2-ol.
| Compound Name | 1-[6-methoxy-2-pyrrolidin-1-yl-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-yl]piperidin-2-ol |
|---|---|
| PubChem CID | 163722459 |
| Molecular Formula | C25H37N5O3 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.29 |
| IUPAC Name | 1-[6-methoxy-2-pyrrolidin-1-yl-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-yl]piperidin-2-ol |
| SMILES | COc1cc2c(N3CCCCC3O)nc(N3CCCC3)nc2cc1OCCCN1CCCC1 |
| InChI | InChI=1S/C25H37N5O3/c1-32-21-17-19-20(18-22(21)33-16-8-12-28-10-4-5-11-28)26-25(29-13-6-7-14-29)27-24(19)30-15-3-2-9-23(30)31/h17-18,23,31H,2-16H2,1H3 |
| InChIKey | DEQLPRHCNJRZCP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 74.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|