C30H40N6O5S — CID 130454693
4-[3-[4-[4-(benzenesulfonyl)piperazin-1-yl]-6-methoxy-2-pyrrolidin-1-ylquinazolin-7-yl]oxypropyl]morpholine (PubChem CID 130454693) has the molecular formula C30H40N6O5S and a molecular weight of 596.75 g/mol. Its IUPAC name is 4-[3-[4-[4-(benzenesulfonyl)piperazin-1-yl]-6-methoxy-2-pyrrolidin-1-ylquinazolin-7-yl]oxypropyl]morpholine.
| Compound Name | 4-[3-[4-[4-(benzenesulfonyl)piperazin-1-yl]-6-methoxy-2-pyrrolidin-1-ylquinazolin-7-yl]oxypropyl]morpholine |
|---|---|
| PubChem CID | 130454693 |
| Molecular Formula | C30H40N6O5S |
| Molecular Weight | 596.75 g/mol |
| Exact Mass | 596.28 |
| IUPAC Name | 4-[3-[4-[4-(benzenesulfonyl)piperazin-1-yl]-6-methoxy-2-pyrrolidin-1-ylquinazolin-7-yl]oxypropyl]morpholine |
| SMILES | COc1cc2c(N3CCN(S(=O)(=O)c4ccccc4)CC3)nc(N3CCCC3)nc2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C30H40N6O5S/c1-39-27-22-25-26(23-28(27)41-19-7-10-33-17-20-40-21-18-33)31-30(35-11-5-6-12-35)32-29(25)34-13-15-36(16-14-34)42(37,38)24-8-3-2-4-9-24/h2-4,8-9,22-23H,5-7,10-21H2,1H3 |
| InChIKey | VVUVMDNFIKDJSF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.75 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|