C27H44N6O5 — CID 146610097
[4-[2-(dimethylamino)-6-methoxy-7-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]piperazin-1-yl]-[(2-methylpropan-2-yl)oxy]methanol (PubChem CID 146610097) has the molecular formula C27H44N6O5 and a molecular weight of 532.69 g/mol. Its IUPAC name is [4-[2-(dimethylamino)-6-methoxy-7-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]piperazin-1-yl]-[(2-methylpropan-2-yl)oxy]methanol.
| Compound Name | [4-[2-(dimethylamino)-6-methoxy-7-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]piperazin-1-yl]-[(2-methylpropan-2-yl)oxy]methanol |
|---|---|
| PubChem CID | 146610097 |
| Molecular Formula | C27H44N6O5 |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.34 |
| IUPAC Name | [4-[2-(dimethylamino)-6-methoxy-7-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]piperazin-1-yl]-[(2-methylpropan-2-yl)oxy]methanol |
| SMILES | COc1cc2c(N3CCN(C(O)OC(C)(C)C)CC3)nc(N(C)C)nc2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C27H44N6O5/c1-27(2,3)38-26(34)33-11-9-32(10-12-33)24-20-18-22(35-6)23(19-21(20)28-25(29-24)30(4)5)37-15-7-8-31-13-16-36-17-14-31/h18-19,26,34H,7-17H2,1-6H3 |
| InChIKey | GYCQZEWMWXPYCI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 95.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|