C27H42N6O2 — CID 175794827
4-(2-cyclopentylpiperazin-1-yl)-6-methoxy-N,N-dimethyl-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-2-amine (PubChem CID 175794827) has the molecular formula C27H42N6O2 and a molecular weight of 482.67 g/mol. Its IUPAC name is 4-(2-cyclopentylpiperazin-1-yl)-6-methoxy-N,N-dimethyl-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-2-amine.
| Compound Name | 4-(2-cyclopentylpiperazin-1-yl)-6-methoxy-N,N-dimethyl-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-2-amine |
|---|---|
| PubChem CID | 175794827 |
| Molecular Formula | C27H42N6O2 |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.34 |
| IUPAC Name | 4-(2-cyclopentylpiperazin-1-yl)-6-methoxy-N,N-dimethyl-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-2-amine |
| SMILES | COc1cc2c(N3CCNCC3C3CCCC3)nc(N(C)C)nc2cc1OCCCN1CCCC1 |
| InChI | InChI=1S/C27H42N6O2/c1-31(2)27-29-22-18-25(35-16-8-14-32-12-6-7-13-32)24(34-3)17-21(22)26(30-27)33-15-11-28-19-23(33)20-9-4-5-10-20/h17-18,20,23,28H,4-16,19H2,1-3H3 |
| InChIKey | IOHDQOMCPUMHSZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 65.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|