C27H42N6O3 — CID 163609825
1-[6-methoxy-2-(4-methyl-1,4-diazepan-1-yl)-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-yl]piperidin-2-ol (PubChem CID 163609825) has the molecular formula C27H42N6O3 and a molecular weight of 498.67 g/mol. Its IUPAC name is 1-[6-methoxy-2-(4-methyl-1,4-diazepan-1-yl)-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-yl]piperidin-2-ol.
| Compound Name | 1-[6-methoxy-2-(4-methyl-1,4-diazepan-1-yl)-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-yl]piperidin-2-ol |
|---|---|
| PubChem CID | 163609825 |
| Molecular Formula | C27H42N6O3 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.33 |
| IUPAC Name | 1-[6-methoxy-2-(4-methyl-1,4-diazepan-1-yl)-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-yl]piperidin-2-ol |
| SMILES | COc1cc2c(N3CCCCC3O)nc(N3CCCN(C)CC3)nc2cc1OCCCN1CCCC1 |
| InChI | InChI=1S/C27H42N6O3/c1-30-10-7-14-32(17-16-30)27-28-22-20-24(36-18-8-13-31-11-5-6-12-31)23(35-2)19-21(22)26(29-27)33-15-4-3-9-25(33)34/h19-20,25,34H,3-18H2,1-2H3 |
| InChIKey | ANPXVVBBDRDQTL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|