C26H40N6O4S — CID 163809675
N-(1,1-dioxothian-4-yl)-6-methoxy-2-(4-methylpiperazin-1-yl)-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-amine (PubChem CID 163809675) has the molecular formula C26H40N6O4S and a molecular weight of 532.71 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-6-methoxy-2-(4-methylpiperazin-1-yl)-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-amine.
| Compound Name | N-(1,1-dioxothian-4-yl)-6-methoxy-2-(4-methylpiperazin-1-yl)-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-amine |
|---|---|
| PubChem CID | 163809675 |
| Molecular Formula | C26H40N6O4S |
| Molecular Weight | 532.71 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-6-methoxy-2-(4-methylpiperazin-1-yl)-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-amine |
| SMILES | COc1cc2c(NC3CCS(=O)(=O)CC3)nc(N3CCN(C)CC3)nc2cc1OCCCN1CCCC1 |
| InChI | InChI=1S/C26H40N6O4S/c1-30-11-13-32(14-12-30)26-28-22-19-24(36-15-5-10-31-8-3-4-9-31)23(35-2)18-21(22)25(29-26)27-20-6-16-37(33,34)17-7-20/h18-20H,3-17H2,1-2H3,(H,27,28,29) |
| InChIKey | NMDFPYYTXXIYFX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.71 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|