C23H35N5O5S — CID 163772375
4-N-(1,1-dioxothian-4-yl)-6-methoxy-2-N-(methoxymethyl)-7-(3-pyrrolidin-1-ylpropoxy)quinazoline-2,4-diamine (PubChem CID 163772375) has the molecular formula C23H35N5O5S and a molecular weight of 493.63 g/mol. Its IUPAC name is 4-N-(1,1-dioxothian-4-yl)-6-methoxy-2-N-(methoxymethyl)-7-(3-pyrrolidin-1-ylpropoxy)quinazoline-2,4-diamine.
| Compound Name | 4-N-(1,1-dioxothian-4-yl)-6-methoxy-2-N-(methoxymethyl)-7-(3-pyrrolidin-1-ylpropoxy)quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 163772375 |
| Molecular Formula | C23H35N5O5S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | 4-N-(1,1-dioxothian-4-yl)-6-methoxy-2-N-(methoxymethyl)-7-(3-pyrrolidin-1-ylpropoxy)quinazoline-2,4-diamine |
| SMILES | COCNc1nc(NC2CCS(=O)(=O)CC2)c2cc(OC)c(OCCCN3CCCC3)cc2n1 |
| InChI | InChI=1S/C23H35N5O5S/c1-31-16-24-23-26-19-15-21(33-11-5-10-28-8-3-4-9-28)20(32-2)14-18(19)22(27-23)25-17-6-12-34(29,30)13-7-17/h14-15,17H,3-13,16H2,1-2H3,(H2,24,25,26,27) |
| InChIKey | BKMCXWOZYHWKJG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 114.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|