C24H31N5O3S — CID 163855179
2-(azetidin-1-yl)-N-(1,1-dioxothian-4-yl)-6-methoxy-7-(3-pyrrolidin-1-ylprop-1-ynyl)quinazolin-4-amine (PubChem CID 163855179) has the molecular formula C24H31N5O3S and a molecular weight of 469.61 g/mol. Its IUPAC name is 2-(azetidin-1-yl)-N-(1,1-dioxothian-4-yl)-6-methoxy-7-(3-pyrrolidin-1-ylprop-1-ynyl)quinazolin-4-amine.
| Compound Name | 2-(azetidin-1-yl)-N-(1,1-dioxothian-4-yl)-6-methoxy-7-(3-pyrrolidin-1-ylprop-1-ynyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 163855179 |
| Molecular Formula | C24H31N5O3S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 2-(azetidin-1-yl)-N-(1,1-dioxothian-4-yl)-6-methoxy-7-(3-pyrrolidin-1-ylprop-1-ynyl)quinazolin-4-amine |
| SMILES | COc1cc2c(NC3CCS(=O)(=O)CC3)nc(N3CCC3)nc2cc1C#CCN1CCCC1 |
| InChI | InChI=1S/C24H31N5O3S/c1-32-22-17-20-21(16-18(22)6-4-11-28-9-2-3-10-28)26-24(29-12-5-13-29)27-23(20)25-19-7-14-33(30,31)15-8-19/h16-17,19H,2-3,5,7-15H2,1H3,(H,25,26,27) |
| InChIKey | DADLXZXEEXDSIT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|