C31H46N6O — CID 162761687
6-methoxy-2-piperidin-1-yl-7-(4-piperidin-1-ylbut-1-ynyl)-N-(1-propan-2-ylpiperidin-4-yl)quinazolin-4-amine (PubChem CID 162761687) has the molecular formula C31H46N6O and a molecular weight of 518.75 g/mol. Its IUPAC name is 6-methoxy-2-piperidin-1-yl-7-(4-piperidin-1-ylbut-1-ynyl)-N-(1-propan-2-ylpiperidin-4-yl)quinazolin-4-amine.
| Compound Name | 6-methoxy-2-piperidin-1-yl-7-(4-piperidin-1-ylbut-1-ynyl)-N-(1-propan-2-ylpiperidin-4-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 162761687 |
| Molecular Formula | C31H46N6O |
| Molecular Weight | 518.75 g/mol |
| Exact Mass | 518.37 |
| IUPAC Name | 6-methoxy-2-piperidin-1-yl-7-(4-piperidin-1-ylbut-1-ynyl)-N-(1-propan-2-ylpiperidin-4-yl)quinazolin-4-amine |
| SMILES | COc1cc2c(NC3CCN(C(C)C)CC3)nc(N3CCCCC3)nc2cc1C#CCCN1CCCCC1 |
| InChI | InChI=1S/C31H46N6O/c1-24(2)36-20-13-26(14-21-36)32-30-27-23-29(38-3)25(12-6-11-17-35-15-7-4-8-16-35)22-28(27)33-31(34-30)37-18-9-5-10-19-37/h22-24,26H,4-5,7-11,13-21H2,1-3H3,(H,32,33,34) |
| InChIKey | RHZZBVINFHBNIK-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 56.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.75 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|