C56H84N12O2 — CID 170323529
7-[4-(dimethylamino)but-1-ynyl]-6-methoxy-2-piperidin-1-yl-N-(1-propan-2-ylpiperidin-4-yl)quinazolin-4-amine (PubChem CID 170323529) has the molecular formula C56H84N12O2 and a molecular weight of 957.37 g/mol. Its IUPAC name is 7-[4-(dimethylamino)but-1-ynyl]-6-methoxy-2-piperidin-1-yl-N-(1-propan-2-ylpiperidin-4-yl)quinazolin-4-amine.
| Compound Name | 7-[4-(dimethylamino)but-1-ynyl]-6-methoxy-2-piperidin-1-yl-N-(1-propan-2-ylpiperidin-4-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 170323529 |
| Molecular Formula | C56H84N12O2 |
| Molecular Weight | 957.37 g/mol |
| Exact Mass | 956.68 |
| IUPAC Name | 7-[4-(dimethylamino)but-1-ynyl]-6-methoxy-2-piperidin-1-yl-N-(1-propan-2-ylpiperidin-4-yl)quinazolin-4-amine |
| SMILES | COc1cc2c(NC3CCN(C(C)C)CC3)nc(N3CCCCC3)nc2cc1C#CCCN(C)C.COc1cc2c(NC3CCN(C(C)C)CC3)nc(N3CCCCC3)nc2cc1C#CCCN(C)C |
| InChI | InChI=1S/2C28H42N6O/c2*1-21(2)33-17-12-23(13-18-33)29-27-24-20-26(35-5)22(11-7-10-14-32(3)4)19-25(24)30-28(31-27)34-15-8-6-9-16-34/h2*19-21,23H,6,8-10,12-18H2,1-5H3,(H,29,30,31) |
| InChIKey | OFCHSSGAXYVTRH-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 957.37 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|