C25H33N5O2 — CID 163722458
6-methoxy-N-(oxan-3-yl)-2-pyrrolidin-1-yl-7-(3-pyrrolidin-1-ylprop-1-ynyl)quinazolin-4-amine (PubChem CID 163722458) has the molecular formula C25H33N5O2 and a molecular weight of 435.57 g/mol. Its IUPAC name is 6-methoxy-N-(oxan-3-yl)-2-pyrrolidin-1-yl-7-(3-pyrrolidin-1-ylprop-1-ynyl)quinazolin-4-amine.
| Compound Name | 6-methoxy-N-(oxan-3-yl)-2-pyrrolidin-1-yl-7-(3-pyrrolidin-1-ylprop-1-ynyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 163722458 |
| Molecular Formula | C25H33N5O2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | 6-methoxy-N-(oxan-3-yl)-2-pyrrolidin-1-yl-7-(3-pyrrolidin-1-ylprop-1-ynyl)quinazolin-4-amine |
| SMILES | COc1cc2c(NC3CCCOC3)nc(N3CCCC3)nc2cc1C#CCN1CCCC1 |
| InChI | InChI=1S/C25H33N5O2/c1-31-23-17-21-22(16-19(23)8-6-12-29-10-2-3-11-29)27-25(30-13-4-5-14-30)28-24(21)26-20-9-7-15-32-18-20/h16-17,20H,2-5,7,9-15,18H2,1H3,(H,26,27,28) |
| InChIKey | KSDLPQVCJLSXQV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|