C26H33F2N5OS — CID 169082820
2-(4,4-difluoropiperidin-1-yl)-6-methoxy-7-(3-pyrrolidin-1-ylprop-1-ynyl)-N-(thian-4-yl)quinazolin-4-amine (PubChem CID 169082820) has the molecular formula C26H33F2N5OS and a molecular weight of 501.65 g/mol. Its IUPAC name is 2-(4,4-difluoropiperidin-1-yl)-6-methoxy-7-(3-pyrrolidin-1-ylprop-1-ynyl)-N-(thian-4-yl)quinazolin-4-amine.
| Compound Name | 2-(4,4-difluoropiperidin-1-yl)-6-methoxy-7-(3-pyrrolidin-1-ylprop-1-ynyl)-N-(thian-4-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 169082820 |
| Molecular Formula | C26H33F2N5OS |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | 2-(4,4-difluoropiperidin-1-yl)-6-methoxy-7-(3-pyrrolidin-1-ylprop-1-ynyl)-N-(thian-4-yl)quinazolin-4-amine |
| SMILES | COc1cc2c(NC3CCSCC3)nc(N3CCC(F)(F)CC3)nc2cc1C#CCN1CCCC1 |
| InChI | InChI=1S/C26H33F2N5OS/c1-34-23-18-21-22(17-19(23)5-4-12-32-10-2-3-11-32)30-25(33-13-8-26(27,28)9-14-33)31-24(21)29-20-6-15-35-16-7-20/h17-18,20H,2-3,6-16H2,1H3,(H,29,30,31) |
| InChIKey | ZWNZJFDMJNNHQW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|