C26H28F2N6O — CID 163840788
2-(4,4-difluoropiperidin-1-yl)-6-methoxy-N-pyridin-2-yl-7-(3-pyrrolidin-1-ylprop-1-ynyl)quinazolin-4-amine (PubChem CID 163840788) has the molecular formula C26H28F2N6O and a molecular weight of 478.55 g/mol. Its IUPAC name is 2-(4,4-difluoropiperidin-1-yl)-6-methoxy-N-pyridin-2-yl-7-(3-pyrrolidin-1-ylprop-1-ynyl)quinazolin-4-amine.
| Compound Name | 2-(4,4-difluoropiperidin-1-yl)-6-methoxy-N-pyridin-2-yl-7-(3-pyrrolidin-1-ylprop-1-ynyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 163840788 |
| Molecular Formula | C26H28F2N6O |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | 2-(4,4-difluoropiperidin-1-yl)-6-methoxy-N-pyridin-2-yl-7-(3-pyrrolidin-1-ylprop-1-ynyl)quinazolin-4-amine |
| SMILES | COc1cc2c(Nc3ccccn3)nc(N3CCC(F)(F)CC3)nc2cc1C#CCN1CCCC1 |
| InChI | InChI=1S/C26H28F2N6O/c1-35-22-18-20-21(17-19(22)7-6-14-33-12-4-5-13-33)30-25(34-15-9-26(27,28)10-16-34)32-24(20)31-23-8-2-3-11-29-23/h2-3,8,11,17-18H,4-5,9-10,12-16H2,1H3,(H,29,30,31,32) |
| InChIKey | JJJGZETWJUDHQE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|