C23H30F2N8O2 — CID 165146472
2-(4,4-difluoropiperidin-1-yl)-6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)-N-(2H-triazol-4-yl)quinazolin-4-amine (PubChem CID 165146472) has the molecular formula C23H30F2N8O2 and a molecular weight of 488.54 g/mol. Its IUPAC name is 2-(4,4-difluoropiperidin-1-yl)-6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)-N-(2H-triazol-4-yl)quinazolin-4-amine.
| Compound Name | 2-(4,4-difluoropiperidin-1-yl)-6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)-N-(2H-triazol-4-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 165146472 |
| Molecular Formula | C23H30F2N8O2 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | 2-(4,4-difluoropiperidin-1-yl)-6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)-N-(2H-triazol-4-yl)quinazolin-4-amine |
| SMILES | COc1cc2c(Nc3cn[nH]n3)nc(N3CCC(F)(F)CC3)nc2cc1OCCCN1CCCC1 |
| InChI | InChI=1S/C23H30F2N8O2/c1-34-18-13-16-17(14-19(18)35-12-4-9-32-7-2-3-8-32)27-22(33-10-5-23(24,25)6-11-33)29-21(16)28-20-15-26-31-30-20/h13-15H,2-12H2,1H3,(H2,26,27,28,29,30,31) |
| InChIKey | PFJPLFCQRNNFPU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 104.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|