C22H31F2N5O2 — CID 122191700
2-(3,3-difluoroazetidin-1-yl)-6,7-dimethoxy-N-(5-pyrrolidin-1-ylpentyl)quinazolin-4-amine (PubChem CID 122191700) has the molecular formula C22H31F2N5O2 and a molecular weight of 435.52 g/mol. Its IUPAC name is 2-(3,3-difluoroazetidin-1-yl)-6,7-dimethoxy-N-(5-pyrrolidin-1-ylpentyl)quinazolin-4-amine.
| Compound Name | 2-(3,3-difluoroazetidin-1-yl)-6,7-dimethoxy-N-(5-pyrrolidin-1-ylpentyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 122191700 |
| Molecular Formula | C22H31F2N5O2 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | 2-(3,3-difluoroazetidin-1-yl)-6,7-dimethoxy-N-(5-pyrrolidin-1-ylpentyl)quinazolin-4-amine |
| SMILES | COc1cc2nc(N3CC(F)(F)C3)nc(NCCCCCN3CCCC3)c2cc1OC |
| InChI | InChI=1S/C22H31F2N5O2/c1-30-18-12-16-17(13-19(18)31-2)26-21(29-14-22(23,24)15-29)27-20(16)25-8-4-3-5-9-28-10-6-7-11-28/h12-13H,3-11,14-15H2,1-2H3,(H,25,26,27) |
| InChIKey | VRWHKKJVCPPFNN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|