C28H46N6O2 — CID 122191704
6,7-dimethoxy-2-N-methyl-2-N-(4-pyrrolidin-1-ylbutyl)-4-N-(5-pyrrolidin-1-ylpentyl)quinazoline-2,4-diamine (PubChem CID 122191704) has the molecular formula C28H46N6O2 and a molecular weight of 498.72 g/mol. Its IUPAC name is 6,7-dimethoxy-2-N-methyl-2-N-(4-pyrrolidin-1-ylbutyl)-4-N-(5-pyrrolidin-1-ylpentyl)quinazoline-2,4-diamine.
| Compound Name | 6,7-dimethoxy-2-N-methyl-2-N-(4-pyrrolidin-1-ylbutyl)-4-N-(5-pyrrolidin-1-ylpentyl)quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 122191704 |
| Molecular Formula | C28H46N6O2 |
| Molecular Weight | 498.72 g/mol |
| Exact Mass | 498.37 |
| IUPAC Name | 6,7-dimethoxy-2-N-methyl-2-N-(4-pyrrolidin-1-ylbutyl)-4-N-(5-pyrrolidin-1-ylpentyl)quinazoline-2,4-diamine |
| SMILES | COc1cc2nc(N(C)CCCCN3CCCC3)nc(NCCCCCN3CCCC3)c2cc1OC |
| InChI | InChI=1S/C28H46N6O2/c1-32(14-7-8-16-34-19-11-12-20-34)28-30-24-22-26(36-3)25(35-2)21-23(24)27(31-28)29-13-5-4-6-15-33-17-9-10-18-33/h21-22H,4-20H2,1-3H3,(H,29,30,31) |
| InChIKey | FLSMAKDRXCUGTG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 65.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.72 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|