C22H31N5O5 — CID 25126366
N-[3-[[6,7-dimethoxy-4-(propanoylamino)quinazolin-2-yl]-methylamino]propyl]oxolane-2-carboxamide (PubChem CID 25126366) has the molecular formula C22H31N5O5 and a molecular weight of 445.52 g/mol. Its IUPAC name is N-[3-[[6,7-dimethoxy-4-(propanoylamino)quinazolin-2-yl]-methylamino]propyl]oxolane-2-carboxamide.
| Compound Name | N-[3-[[6,7-dimethoxy-4-(propanoylamino)quinazolin-2-yl]-methylamino]propyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 25126366 |
| Molecular Formula | C22H31N5O5 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | N-[3-[[6,7-dimethoxy-4-(propanoylamino)quinazolin-2-yl]-methylamino]propyl]oxolane-2-carboxamide |
| SMILES | CCC(=O)Nc1nc(N(C)CCCNC(=O)C2CCCO2)nc2cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C22H31N5O5/c1-5-19(28)25-20-14-12-17(30-3)18(31-4)13-15(14)24-22(26-20)27(2)10-7-9-23-21(29)16-8-6-11-32-16/h12-13,16H,5-11H2,1-4H3,(H,23,29)(H,24,25,26,28) |
| InChIKey | HEHTZFXXTFLEPN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 114.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|