C19H28ClN5O4 — CID 76973780
N-[3-[[4-amino-6,7-bis(trideuteriomethoxy)quinazolin-2-yl]-methylamino]propyl]oxolane-2-carboxamide;hydrochloride (PubChem CID 76973780) has the molecular formula C19H28ClN5O4 and a molecular weight of 431.95 g/mol. Its IUPAC name is N-[3-[[4-amino-6,7-bis(trideuteriomethoxy)quinazolin-2-yl]-methylamino]propyl]oxolane-2-carboxamide;hydrochloride.
| Compound Name | N-[3-[[4-amino-6,7-bis(trideuteriomethoxy)quinazolin-2-yl]-methylamino]propyl]oxolane-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 76973780 |
| Molecular Formula | C19H28ClN5O4 |
| Molecular Weight | 431.95 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | N-[3-[[4-amino-6,7-bis(trideuteriomethoxy)quinazolin-2-yl]-methylamino]propyl]oxolane-2-carboxamide;hydrochloride |
| SMILES | Cl.[2H]C([2H])([2H])Oc1cc2nc(N(C)CCCNC(=O)C3CCCO3)nc(N)c2cc1OC([2H])([2H])[2H] |
| InChI | InChI=1S/C19H27N5O4.ClH/c1-24(8-5-7-21-18(25)14-6-4-9-28-14)19-22-13-11-16(27-3)15(26-2)10-12(13)17(20)23-19;/h10-11,14H,4-9H2,1-3H3,(H,21,25)(H2,20,22,23);1H/i2D3,3D3; |
| InChIKey | YTNKWDJILNVLGX-HVTBMTIBSA-N |
| XLogP | 1.77 |
| TPSA | 111.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.95 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|