C19H28N6O — CID 143494263
N-[3-[(4-amino-6,7-dimethylquinazolin-2-yl)-methylamino]propyl]pyrrolidine-2-carboxamide (PubChem CID 143494263) has the molecular formula C19H28N6O and a molecular weight of 356.47 g/mol. Its IUPAC name is N-[3-[(4-amino-6,7-dimethylquinazolin-2-yl)-methylamino]propyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[3-[(4-amino-6,7-dimethylquinazolin-2-yl)-methylamino]propyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143494263 |
| Molecular Formula | C19H28N6O |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | N-[3-[(4-amino-6,7-dimethylquinazolin-2-yl)-methylamino]propyl]pyrrolidine-2-carboxamide |
| SMILES | Cc1cc2nc(N(C)CCCNC(=O)C3CCCN3)nc(N)c2cc1C |
| InChI | InChI=1S/C19H28N6O/c1-12-10-14-16(11-13(12)2)23-19(24-17(14)20)25(3)9-5-8-22-18(26)15-6-4-7-21-15/h10-11,15,21H,4-9H2,1-3H3,(H,22,26)(H2,20,23,24) |
| InChIKey | ZDKLENYBMFFUNS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|