C15H22N2O — CID 83632123
N-[2-(3,5-dimethylphenyl)ethyl]pyrrolidine-2-carboxamide (PubChem CID 83632123) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is N-[2-(3,5-dimethylphenyl)ethyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[2-(3,5-dimethylphenyl)ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 83632123 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | N-[2-(3,5-dimethylphenyl)ethyl]pyrrolidine-2-carboxamide |
| SMILES | Cc1cc(C)cc(CCNC(=O)C2CCCN2)c1 |
| InChI | InChI=1S/C15H22N2O/c1-11-8-12(2)10-13(9-11)5-7-17-15(18)14-4-3-6-16-14/h8-10,14,16H,3-7H2,1-2H3,(H,17,18) |
| InChIKey | LSCWUQQYGOQPBZ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |