C23H26ClN5O4 — CID 12919466
N-[3-[(4-amino-6,7-dimethoxyquinazolin-2-yl)-methylamino]propyl]-1-benzofuran-2-carboxamide;hydrochloride (PubChem CID 12919466) has the molecular formula C23H26ClN5O4 and a molecular weight of 471.95 g/mol. Its IUPAC name is N-[3-[(4-amino-6,7-dimethoxyquinazolin-2-yl)-methylamino]propyl]-1-benzofuran-2-carboxamide;hydrochloride.
| Compound Name | N-[3-[(4-amino-6,7-dimethoxyquinazolin-2-yl)-methylamino]propyl]-1-benzofuran-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 12919466 |
| Molecular Formula | C23H26ClN5O4 |
| Molecular Weight | 471.95 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | N-[3-[(4-amino-6,7-dimethoxyquinazolin-2-yl)-methylamino]propyl]-1-benzofuran-2-carboxamide;hydrochloride |
| SMILES | COc1cc2nc(N(C)CCCNC(=O)c3cc4ccccc4o3)nc(N)c2cc1OC.Cl |
| InChI | InChI=1S/C23H25N5O4.ClH/c1-28(10-6-9-25-22(29)20-11-14-7-4-5-8-17(14)32-20)23-26-16-13-19(31-3)18(30-2)12-15(16)21(24)27-23;/h4-5,7-8,11-13H,6,9-10H2,1-3H3,(H,25,29)(H2,24,26,27);1H |
| InChIKey | JIKLFKSJZLMWKT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 115.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.95 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|