C24H30N8O4 — CID 169437840
2-N-[3-[(4-amino-6,7-dimethoxyquinazolin-2-yl)-(trideuteriomethyl)amino]propyl]-6,7-dimethoxyquinazoline-2,4-diamine (PubChem CID 169437840) has the molecular formula C24H30N8O4 and a molecular weight of 497.57 g/mol. Its IUPAC name is 2-N-[3-[(4-amino-6,7-dimethoxyquinazolin-2-yl)-(trideuteriomethyl)amino]propyl]-6,7-dimethoxyquinazoline-2,4-diamine.
| Compound Name | 2-N-[3-[(4-amino-6,7-dimethoxyquinazolin-2-yl)-(trideuteriomethyl)amino]propyl]-6,7-dimethoxyquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 169437840 |
| Molecular Formula | C24H30N8O4 |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | 2-N-[3-[(4-amino-6,7-dimethoxyquinazolin-2-yl)-(trideuteriomethyl)amino]propyl]-6,7-dimethoxyquinazoline-2,4-diamine |
| SMILES | [2H]C([2H])([2H])N(CCCNc1nc(N)c2cc(OC)c(OC)cc2n1)c1nc(N)c2cc(OC)c(OC)cc2n1 |
| InChI | InChI=1S/C24H30N8O4/c1-32(24-29-16-12-20(36-5)18(34-3)10-14(16)22(26)31-24)8-6-7-27-23-28-15-11-19(35-4)17(33-2)9-13(15)21(25)30-23/h9-12H,6-8H2,1-5H3,(H2,26,29,31)(H3,25,27,28,30)/i1D3 |
| InChIKey | CEKUOLRGTZEHMC-FIBGUPNXSA-N |
| XLogP | 2.71 |
| TPSA | 155.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|