C36H56N10O4S2 — CID 10010336
2-N-[6-[2-[2-[6-[(4-amino-6,7-dimethoxyquinazolin-2-yl)amino]hexylamino]ethyldisulfanyl]ethylamino]hexyl]-6,7-dimethoxyquinazoline-2,4-diamine (PubChem CID 10010336) has the molecular formula C36H56N10O4S2 and a molecular weight of 757.04 g/mol. Its IUPAC name is 2-N-[6-[2-[2-[6-[(4-amino-6,7-dimethoxyquinazolin-2-yl)amino]hexylamino]ethyldisulfanyl]ethylamino]hexyl]-6,7-dimethoxyquinazoline-2,4-diamine.
| Compound Name | 2-N-[6-[2-[2-[6-[(4-amino-6,7-dimethoxyquinazolin-2-yl)amino]hexylamino]ethyldisulfanyl]ethylamino]hexyl]-6,7-dimethoxyquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 10010336 |
| Molecular Formula | C36H56N10O4S2 |
| Molecular Weight | 757.04 g/mol |
| Exact Mass | 756.39 |
| IUPAC Name | 2-N-[6-[2-[2-[6-[(4-amino-6,7-dimethoxyquinazolin-2-yl)amino]hexylamino]ethyldisulfanyl]ethylamino]hexyl]-6,7-dimethoxyquinazoline-2,4-diamine |
| SMILES | COc1cc2nc(NCCCCCCNCCSSCCNCCCCCCNc3nc(N)c4cc(OC)c(OC)cc4n3)nc(N)c2cc1OC |
| InChI | InChI=1S/C36H56N10O4S2/c1-47-29-21-25-27(23-31(29)49-3)43-35(45-33(25)37)41-15-11-7-5-9-13-39-17-19-51-52-20-18-40-14-10-6-8-12-16-42-36-44-28-24-32(50-4)30(48-2)22-26(28)34(38)46-36/h21-24,39-40H,5-20H2,1-4H3,(H3,37,41,43,45)(H3,38,42,44,46) |
| InChIKey | XRXVKWBAKQKBME-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 188.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 52 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.04 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|