C21H21N7O4 — CID 135134604
N-[2-[(4-amino-6,7-dimethoxyquinazolin-2-yl)amino]ethyl]-5-phenyl-1,3,4-oxadiazole-2-carboxamide (PubChem CID 135134604) has the molecular formula C21H21N7O4 and a molecular weight of 435.44 g/mol. Its IUPAC name is N-[2-[(4-amino-6,7-dimethoxyquinazolin-2-yl)amino]ethyl]-5-phenyl-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | N-[2-[(4-amino-6,7-dimethoxyquinazolin-2-yl)amino]ethyl]-5-phenyl-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 135134604 |
| Molecular Formula | C21H21N7O4 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | N-[2-[(4-amino-6,7-dimethoxyquinazolin-2-yl)amino]ethyl]-5-phenyl-1,3,4-oxadiazole-2-carboxamide |
| SMILES | COc1cc2nc(NCCNC(=O)c3nnc(-c4ccccc4)o3)nc(N)c2cc1OC |
| InChI | InChI=1S/C21H21N7O4/c1-30-15-10-13-14(11-16(15)31-2)25-21(26-17(13)22)24-9-8-23-18(29)20-28-27-19(32-20)12-6-4-3-5-7-12/h3-7,10-11H,8-9H2,1-2H3,(H,23,29)(H3,22,24,25,26) |
| InChIKey | GBXBZLWCEJTXPK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 150.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|