C21H26ClN5O3 — CID 3049725
N-[3-[(4-amino-6,7-dimethoxyquinazolin-2-yl)amino]propyl]-N-methylbenzamide;hydrochloride (PubChem CID 3049725) has the molecular formula C21H26ClN5O3 and a molecular weight of 431.92 g/mol. Its IUPAC name is N-[3-[(4-amino-6,7-dimethoxyquinazolin-2-yl)amino]propyl]-N-methylbenzamide;hydrochloride.
| Compound Name | N-[3-[(4-amino-6,7-dimethoxyquinazolin-2-yl)amino]propyl]-N-methylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 3049725 |
| Molecular Formula | C21H26ClN5O3 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | N-[3-[(4-amino-6,7-dimethoxyquinazolin-2-yl)amino]propyl]-N-methylbenzamide;hydrochloride |
| SMILES | COc1cc2nc(NCCCN(C)C(=O)c3ccccc3)nc(N)c2cc1OC.Cl |
| InChI | InChI=1S/C21H25N5O3.ClH/c1-26(20(27)14-8-5-4-6-9-14)11-7-10-23-21-24-16-13-18(29-3)17(28-2)12-15(16)19(22)25-21;/h4-6,8-9,12-13H,7,10-11H2,1-3H3,(H3,22,23,24,25);1H |
| InChIKey | SVJOCNOCOGVSBL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 102.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|