C21H25N5O4 — CID 59237301
methyl N-[2-[[4-(3,4-dimethoxy-N-methylanilino)quinazolin-2-yl]amino]ethyl]carbamate (PubChem CID 59237301) has the molecular formula C21H25N5O4 and a molecular weight of 411.46 g/mol. Its IUPAC name is methyl N-[2-[[4-(3,4-dimethoxy-N-methylanilino)quinazolin-2-yl]amino]ethyl]carbamate.
| Compound Name | methyl N-[2-[[4-(3,4-dimethoxy-N-methylanilino)quinazolin-2-yl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 59237301 |
| Molecular Formula | C21H25N5O4 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | methyl N-[2-[[4-(3,4-dimethoxy-N-methylanilino)quinazolin-2-yl]amino]ethyl]carbamate |
| SMILES | COC(=O)NCCNc1nc(N(C)c2ccc(OC)c(OC)c2)c2ccccc2n1 |
| InChI | InChI=1S/C21H25N5O4/c1-26(14-9-10-17(28-2)18(13-14)29-3)19-15-7-5-6-8-16(15)24-20(25-19)22-11-12-23-21(27)30-4/h5-10,13H,11-12H2,1-4H3,(H,23,27)(H,22,24,25) |
| InChIKey | HSJKBWNHKWDSOT-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|