C24H22N4O2 — CID 143778192
4-[[[4-(4-methoxy-N-methylanilino)quinazolin-2-yl]amino]methyl]benzaldehyde (PubChem CID 143778192) has the molecular formula C24H22N4O2 and a molecular weight of 398.47 g/mol. Its IUPAC name is 4-[[[4-(4-methoxy-N-methylanilino)quinazolin-2-yl]amino]methyl]benzaldehyde.
| Compound Name | 4-[[[4-(4-methoxy-N-methylanilino)quinazolin-2-yl]amino]methyl]benzaldehyde |
|---|---|
| PubChem CID | 143778192 |
| Molecular Formula | C24H22N4O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 4-[[[4-(4-methoxy-N-methylanilino)quinazolin-2-yl]amino]methyl]benzaldehyde |
| SMILES | COc1ccc(N(C)c2nc(NCc3ccc(C=O)cc3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C24H22N4O2/c1-28(19-11-13-20(30-2)14-12-19)23-21-5-3-4-6-22(21)26-24(27-23)25-15-17-7-9-18(16-29)10-8-17/h3-14,16H,15H2,1-2H3,(H,25,26,27) |
| InChIKey | YBCDSEYFLIBMPK-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|