C24H32N4O — CID 143778204
2-[(heptylamino)methyl]-N-(4-methoxyphenyl)-N-methylquinazolin-4-amine (PubChem CID 143778204) has the molecular formula C24H32N4O and a molecular weight of 392.55 g/mol. Its IUPAC name is 2-[(heptylamino)methyl]-N-(4-methoxyphenyl)-N-methylquinazolin-4-amine.
| Compound Name | 2-[(heptylamino)methyl]-N-(4-methoxyphenyl)-N-methylquinazolin-4-amine |
|---|---|
| PubChem CID | 143778204 |
| Molecular Formula | C24H32N4O |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | 2-[(heptylamino)methyl]-N-(4-methoxyphenyl)-N-methylquinazolin-4-amine |
| SMILES | CCCCCCCNCc1nc(N(C)c2ccc(OC)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C24H32N4O/c1-4-5-6-7-10-17-25-18-23-26-22-12-9-8-11-21(22)24(27-23)28(2)19-13-15-20(29-3)16-14-19/h8-9,11-16,25H,4-7,10,17-18H2,1-3H3 |
| InChIKey | VPPXZPWKKZFWJT-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|