C22H25N3O4 — CID 90926744
5-[[4-(4-methoxy-N-methylanilino)quinazolin-2-yl]methoxy]pentanoic acid (PubChem CID 90926744) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is 5-[[4-(4-methoxy-N-methylanilino)quinazolin-2-yl]methoxy]pentanoic acid.
| Compound Name | 5-[[4-(4-methoxy-N-methylanilino)quinazolin-2-yl]methoxy]pentanoic acid |
|---|---|
| PubChem CID | 90926744 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 5-[[4-(4-methoxy-N-methylanilino)quinazolin-2-yl]methoxy]pentanoic acid |
| SMILES | COc1ccc(N(C)c2nc(COCCCCC(=O)O)nc3ccccc23)cc1 |
| InChI | InChI=1S/C22H25N3O4/c1-25(16-10-12-17(28-2)13-11-16)22-18-7-3-4-8-19(18)23-20(24-22)15-29-14-6-5-9-21(26)27/h3-4,7-8,10-13H,5-6,9,14-15H2,1-2H3,(H,26,27) |
| InChIKey | UKPLMKDIEOUXHI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|