C23H25N3O3 — CID 68853969
(E)-7-[4-(4-methoxy-N-methylanilino)quinazolin-2-yl]hept-6-enoic acid (PubChem CID 68853969) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is (E)-7-[4-(4-methoxy-N-methylanilino)quinazolin-2-yl]hept-6-enoic acid.
| Compound Name | (E)-7-[4-(4-methoxy-N-methylanilino)quinazolin-2-yl]hept-6-enoic acid |
|---|---|
| PubChem CID | 68853969 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | (E)-7-[4-(4-methoxy-N-methylanilino)quinazolin-2-yl]hept-6-enoic acid |
| SMILES | COc1ccc(N(C)c2nc(/C=C/CCCCC(=O)O)nc3ccccc23)cc1 |
| InChI | InChI=1S/C23H25N3O3/c1-26(17-13-15-18(29-2)16-14-17)23-19-9-7-8-10-20(19)24-21(25-23)11-5-3-4-6-12-22(27)28/h5,7-11,13-16H,3-4,6,12H2,1-2H3,(H,27,28)/b11-5+ |
| InChIKey | MPETVWVUOYQCII-VZUCSPMQSA-N |
| XLogP | 5.06 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|