C25H32N6O4 — CID 59237266
tert-butyl N-[2-[2-[[4-(4-methoxy-N-methylanilino)quinazolin-2-yl]amino]ethylamino]-2-oxoethyl]carbamate (PubChem CID 59237266) has the molecular formula C25H32N6O4 and a molecular weight of 480.57 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[[4-(4-methoxy-N-methylanilino)quinazolin-2-yl]amino]ethylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[[4-(4-methoxy-N-methylanilino)quinazolin-2-yl]amino]ethylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 59237266 |
| Molecular Formula | C25H32N6O4 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | tert-butyl N-[2-[2-[[4-(4-methoxy-N-methylanilino)quinazolin-2-yl]amino]ethylamino]-2-oxoethyl]carbamate |
| SMILES | COc1ccc(N(C)c2nc(NCCNC(=O)CNC(=O)OC(C)(C)C)nc3ccccc23)cc1 |
| InChI | InChI=1S/C25H32N6O4/c1-25(2,3)35-24(33)28-16-21(32)26-14-15-27-23-29-20-9-7-6-8-19(20)22(30-23)31(4)17-10-12-18(34-5)13-11-17/h6-13H,14-16H2,1-5H3,(H,26,32)(H,28,33)(H,27,29,30) |
| InChIKey | PSJQDTYMRNPRMH-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 117.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|