C20H21N3O4 — CID 71063625
methyl 3-[4-(4-methoxy-N-methylanilino)quinazolin-2-yl]oxypropanoate (PubChem CID 71063625) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is methyl 3-[4-(4-methoxy-N-methylanilino)quinazolin-2-yl]oxypropanoate.
| Compound Name | methyl 3-[4-(4-methoxy-N-methylanilino)quinazolin-2-yl]oxypropanoate |
|---|---|
| PubChem CID | 71063625 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | methyl 3-[4-(4-methoxy-N-methylanilino)quinazolin-2-yl]oxypropanoate |
| SMILES | COC(=O)CCOc1nc(N(C)c2ccc(OC)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C20H21N3O4/c1-23(14-8-10-15(25-2)11-9-14)19-16-6-4-5-7-17(16)21-20(22-19)27-13-12-18(24)26-3/h4-11H,12-13H2,1-3H3 |
| InChIKey | RCJHRZLNJWVHAH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |