C18H18N4O3 — CID 122550234
N-hydroxy-2-[4-[methyl-(2-methylquinazolin-4-yl)amino]phenoxy]acetamide (PubChem CID 122550234) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is N-hydroxy-2-[4-[methyl-(2-methylquinazolin-4-yl)amino]phenoxy]acetamide.
| Compound Name | N-hydroxy-2-[4-[methyl-(2-methylquinazolin-4-yl)amino]phenoxy]acetamide |
|---|---|
| PubChem CID | 122550234 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | N-hydroxy-2-[4-[methyl-(2-methylquinazolin-4-yl)amino]phenoxy]acetamide |
| SMILES | Cc1nc(N(C)c2ccc(OCC(=O)NO)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C18H18N4O3/c1-12-19-16-6-4-3-5-15(16)18(20-12)22(2)13-7-9-14(10-8-13)25-11-17(23)21-24/h3-10,24H,11H2,1-2H3,(H,21,23) |
| InChIKey | MPMPKDWQOVDGGV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|