C19H20N6O3 — CID 59242074
methyl N-[[4-[methyl-(2-methylquinazolin-4-yl)amino]phenyl]carbamoylamino]carbamate (PubChem CID 59242074) has the molecular formula C19H20N6O3 and a molecular weight of 380.41 g/mol. Its IUPAC name is methyl N-[[4-[methyl-(2-methylquinazolin-4-yl)amino]phenyl]carbamoylamino]carbamate.
| Compound Name | methyl N-[[4-[methyl-(2-methylquinazolin-4-yl)amino]phenyl]carbamoylamino]carbamate |
|---|---|
| PubChem CID | 59242074 |
| Molecular Formula | C19H20N6O3 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | methyl N-[[4-[methyl-(2-methylquinazolin-4-yl)amino]phenyl]carbamoylamino]carbamate |
| SMILES | COC(=O)NNC(=O)Nc1ccc(N(C)c2nc(C)nc3ccccc23)cc1 |
| InChI | InChI=1S/C19H20N6O3/c1-12-20-16-7-5-4-6-15(16)17(21-12)25(2)14-10-8-13(9-11-14)22-18(26)23-24-19(27)28-3/h4-11H,1-3H3,(H,24,27)(H2,22,23,26) |
| InChIKey | KBCVUMAPKQRJEK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|