C21H24N4O4 — CID 140857190
N-hydroxy-2-[2-methoxy-5-[methyl-(2-methylquinazolin-4-yl)amino]phenoxy]butanamide (PubChem CID 140857190) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is N-hydroxy-2-[2-methoxy-5-[methyl-(2-methylquinazolin-4-yl)amino]phenoxy]butanamide.
| Compound Name | N-hydroxy-2-[2-methoxy-5-[methyl-(2-methylquinazolin-4-yl)amino]phenoxy]butanamide |
|---|---|
| PubChem CID | 140857190 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | N-hydroxy-2-[2-methoxy-5-[methyl-(2-methylquinazolin-4-yl)amino]phenoxy]butanamide |
| SMILES | CCC(Oc1cc(N(C)c2nc(C)nc3ccccc23)ccc1OC)C(=O)NO |
| InChI | InChI=1S/C21H24N4O4/c1-5-17(21(26)24-27)29-19-12-14(10-11-18(19)28-4)25(3)20-15-8-6-7-9-16(15)22-13(2)23-20/h6-12,17,27H,5H2,1-4H3,(H,24,26) |
| InChIKey | YCVGKZVNGYWHAT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 96.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|