C22H26N4O3 — CID 164621719
2-[2-methoxy-5-[methyl-(2-methylquinazolin-4-yl)amino]phenoxy]-3-methylbutanamide (PubChem CID 164621719) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is 2-[2-methoxy-5-[methyl-(2-methylquinazolin-4-yl)amino]phenoxy]-3-methylbutanamide.
| Compound Name | 2-[2-methoxy-5-[methyl-(2-methylquinazolin-4-yl)amino]phenoxy]-3-methylbutanamide |
|---|---|
| PubChem CID | 164621719 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 2-[2-methoxy-5-[methyl-(2-methylquinazolin-4-yl)amino]phenoxy]-3-methylbutanamide |
| SMILES | COc1ccc(N(C)c2nc(C)nc3ccccc23)cc1OC(C(N)=O)C(C)C |
| InChI | InChI=1S/C22H26N4O3/c1-13(2)20(21(23)27)29-19-12-15(10-11-18(19)28-5)26(4)22-16-8-6-7-9-17(16)24-14(3)25-22/h6-13,20H,1-5H3,(H2,23,27) |
| InChIKey | KJVGWMJKFFMOLE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 90.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |