C22H19N7O4 — CID 122550144
5-[2-methoxy-5-[methyl-(2-methylquinazolin-4-yl)amino]phenoxy]-N-nitrosopyrimidine-2-carboxamide (PubChem CID 122550144) has the molecular formula C22H19N7O4 and a molecular weight of 445.44 g/mol. Its IUPAC name is 5-[2-methoxy-5-[methyl-(2-methylquinazolin-4-yl)amino]phenoxy]-N-nitrosopyrimidine-2-carboxamide.
| Compound Name | 5-[2-methoxy-5-[methyl-(2-methylquinazolin-4-yl)amino]phenoxy]-N-nitrosopyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 122550144 |
| Molecular Formula | C22H19N7O4 |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 5-[2-methoxy-5-[methyl-(2-methylquinazolin-4-yl)amino]phenoxy]-N-nitrosopyrimidine-2-carboxamide |
| SMILES | COc1ccc(N(C)c2nc(C)nc3ccccc23)cc1Oc1cnc(C(=O)NN=O)nc1 |
| InChI | InChI=1S/C22H19N7O4/c1-13-25-17-7-5-4-6-16(17)21(26-13)29(2)14-8-9-18(32-3)19(10-14)33-15-11-23-20(24-12-15)22(30)27-28-31/h4-12H,1-3H3,(H,27,30,31) |
| InChIKey | OCYQTHGUPYUJGI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 131.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|