C21H24N4O2 — CID 134186540
N-hydroxy-5-[3-[methyl-(2-methylquinazolin-4-yl)amino]phenyl]pentanamide (PubChem CID 134186540) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is N-hydroxy-5-[3-[methyl-(2-methylquinazolin-4-yl)amino]phenyl]pentanamide.
| Compound Name | N-hydroxy-5-[3-[methyl-(2-methylquinazolin-4-yl)amino]phenyl]pentanamide |
|---|---|
| PubChem CID | 134186540 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | N-hydroxy-5-[3-[methyl-(2-methylquinazolin-4-yl)amino]phenyl]pentanamide |
| SMILES | Cc1nc(N(C)c2cccc(CCCCC(=O)NO)c2)c2ccccc2n1 |
| InChI | InChI=1S/C21H24N4O2/c1-15-22-19-12-5-4-11-18(19)21(23-15)25(2)17-10-7-9-16(14-17)8-3-6-13-20(26)24-27/h4-5,7,9-12,14,27H,3,6,8,13H2,1-2H3,(H,24,26) |
| InChIKey | QVMNJCRZIBUIIL-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|