C22H27N3O — CID 134186542
N-(3-hexoxyphenyl)-N,2-dimethylquinazolin-4-amine (PubChem CID 134186542) has the molecular formula C22H27N3O and a molecular weight of 349.48 g/mol. Its IUPAC name is N-(3-hexoxyphenyl)-N,2-dimethylquinazolin-4-amine.
| Compound Name | N-(3-hexoxyphenyl)-N,2-dimethylquinazolin-4-amine |
|---|---|
| PubChem CID | 134186542 |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | N-(3-hexoxyphenyl)-N,2-dimethylquinazolin-4-amine |
| SMILES | CCCCCCOc1cccc(N(C)c2nc(C)nc3ccccc23)c1 |
| InChI | InChI=1S/C22H27N3O/c1-4-5-6-9-15-26-19-12-10-11-18(16-19)25(3)22-20-13-7-8-14-21(20)23-17(2)24-22/h7-8,10-14,16H,4-6,9,15H2,1-3H3 |
| InChIKey | FJOHHQGFDJXQOW-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|